C10H12F2N2O6S — CID 107481597
N-(2,2-difluoroethyl)-4-hydroxy-N-(2-hydroxyethyl)-3-nitrobenzenesulfonamide (PubChem CID 107481597) has the molecular formula C10H12F2N2O6S and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-hydroxy-N-(2-hydroxyethyl)-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-4-hydroxy-N-(2-hydroxyethyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 107481597 |
| Molecular Formula | C10H12F2N2O6S |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-hydroxy-N-(2-hydroxyethyl)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N(CCO)CC(F)F)ccc1O |
| InChI | InChI=1S/C10H12F2N2O6S/c11-10(12)6-13(3-4-15)21(19,20)7-1-2-9(16)8(5-7)14(17)18/h1-2,5,10,15-16H,3-4,6H2 |
| InChIKey | UECAIJUZNBFCEH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|