C10H8N4O5S — CID 43328091
N,N-bis(cyanomethyl)-4-hydroxy-3-nitrobenzenesulfonamide (PubChem CID 43328091) has the molecular formula C10H8N4O5S and a molecular weight of 296.26 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-4-hydroxy-3-nitrobenzenesulfonamide.
| Compound Name | N,N-bis(cyanomethyl)-4-hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43328091 |
| Molecular Formula | C10H8N4O5S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N,N-bis(cyanomethyl)-4-hydroxy-3-nitrobenzenesulfonamide |
| SMILES | N#CCN(CC#N)S(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8N4O5S/c11-3-5-13(6-4-12)20(18,19)8-1-2-10(15)9(7-8)14(16)17/h1-2,7,15H,5-6H2 |
| InChIKey | SIDKWBHZRPKALT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|