C12H18N2O5S — CID 61067946
4-hydroxy-N-methyl-N-(3-methylbutyl)-3-nitrobenzenesulfonamide (PubChem CID 61067946) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-hydroxy-N-methyl-N-(3-methylbutyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-methyl-N-(3-methylbutyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 61067946 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-hydroxy-N-methyl-N-(3-methylbutyl)-3-nitrobenzenesulfonamide |
| SMILES | CC(C)CCN(C)S(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H18N2O5S/c1-9(2)6-7-13(3)20(18,19)10-4-5-12(15)11(8-10)14(16)17/h4-5,8-9,15H,6-7H2,1-3H3 |
| InChIKey | IEUWHRJNOWUMNZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|