C13H19FN2O4S — CID 115421903
4-fluoro-N,3-dimethyl-N-(3-methylbutyl)-5-nitrobenzenesulfonamide (PubChem CID 115421903) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethyl-N-(3-methylbutyl)-5-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N,3-dimethyl-N-(3-methylbutyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115421903 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-fluoro-N,3-dimethyl-N-(3-methylbutyl)-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCC(C)C)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C13H19FN2O4S/c1-9(2)5-6-15(4)21(19,20)11-7-10(3)13(14)12(8-11)16(17)18/h7-9H,5-6H2,1-4H3 |
| InChIKey | RXFKLLMETVXDKU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|