C12H17BrN2O4S — CID 106441679
N-(3-bromopropyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide (PubChem CID 106441679) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is N-(3-bromopropyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(3-bromopropyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106441679 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-(3-bromopropyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCCBr)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H17BrN2O4S/c1-9-7-11(8-12(10(9)2)15(16)17)20(18,19)14(3)6-4-5-13/h7-8H,4-6H2,1-3H3 |
| InChIKey | IBJNKQQGEHJULC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|