C13H17N3O4S — CID 63224650
N-(1-cyanopropan-2-yl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide (PubChem CID 63224650) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(1-cyanopropan-2-yl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 63224650 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C(C)CC#N)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H17N3O4S/c1-9-7-12(8-13(11(9)3)16(17)18)21(19,20)15(4)10(2)5-6-14/h7-8,10H,5H2,1-4H3 |
| InChIKey | UVHQEFDEJUZDCH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|