C12H15N3O4S — CID 63225052
N-(1-cyanopropan-2-yl)-N,2-dimethyl-6-nitrobenzenesulfonamide (PubChem CID 63225052) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-N,2-dimethyl-6-nitrobenzenesulfonamide.
| Compound Name | N-(1-cyanopropan-2-yl)-N,2-dimethyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 63225052 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-N,2-dimethyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)N(C)C(C)CC#N |
| InChI | InChI=1S/C12H15N3O4S/c1-9-5-4-6-11(15(16)17)12(9)20(18,19)14(3)10(2)7-8-13/h4-6,10H,7H2,1-3H3 |
| InChIKey | AMZOWCMABCXXCX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|