C11H17N3O4S — CID 62688255
N-(2-aminoethyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide (PubChem CID 62688255) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62688255 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(2-aminoethyl)-N,3,4-trimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCN)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H17N3O4S/c1-8-6-10(7-11(9(8)2)14(15)16)19(17,18)13(3)5-4-12/h6-7H,4-5,12H2,1-3H3 |
| InChIKey | CERAWNLYHLIDAG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|