C12H17FN2O5S — CID 115887101
4-fluoro-N-(3-hydroxybutyl)-N,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 115887101) has the molecular formula C12H17FN2O5S and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxybutyl)-N,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N-(3-hydroxybutyl)-N,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115887101 |
| Molecular Formula | C12H17FN2O5S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-fluoro-N-(3-hydroxybutyl)-N,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCC(C)O)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H17FN2O5S/c1-8-6-10(7-11(12(8)13)15(17)18)21(19,20)14(3)5-4-9(2)16/h6-7,9,16H,4-5H2,1-3H3 |
| InChIKey | LLMSNOHCGZWMAK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|