C11H12N2O4S — CID 60681266
3,4-dimethyl-5-nitro-N-prop-2-ynylbenzenesulfonamide (PubChem CID 60681266) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 3,4-dimethyl-5-nitro-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 3,4-dimethyl-5-nitro-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 60681266 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3,4-dimethyl-5-nitro-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCNS(=O)(=O)c1cc(C)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2O4S/c1-4-5-12-18(16,17)10-6-8(2)9(3)11(7-10)13(14)15/h1,6-7,12H,5H2,2-3H3 |
| InChIKey | XEKFTDHLMUGEMV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|