C13H20N2O5S — CID 66108645
N-(4-hydroxy-2-methylbutyl)-3,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 66108645) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutyl)-3,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-hydroxy-2-methylbutyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66108645 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-(4-hydroxy-2-methylbutyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(C)CCO)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H20N2O5S/c1-9(4-5-16)8-14-21(19,20)12-6-10(2)11(3)13(7-12)15(17)18/h6-7,9,14,16H,4-5,8H2,1-3H3 |
| InChIKey | KWXRMEQNANVUAA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|