C11H17N3O4S — CID 62659310
3,4-dimethyl-N-[2-(methylamino)ethyl]-5-nitrobenzenesulfonamide (PubChem CID 62659310) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-(methylamino)ethyl]-5-nitrobenzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[2-(methylamino)ethyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62659310 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3,4-dimethyl-N-[2-(methylamino)ethyl]-5-nitrobenzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1cc(C)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H17N3O4S/c1-8-6-10(7-11(9(8)2)14(15)16)19(17,18)13-5-4-12-3/h6-7,12-13H,4-5H2,1-3H3 |
| InChIKey | HBNXKNXMDRMALG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|