C14H21N3O5S — CID 16644692
3,4-dimethyl-N-(2-morpholin-4-ylethyl)-5-nitrobenzenesulfonamide (PubChem CID 16644692) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-morpholin-4-ylethyl)-5-nitrobenzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-(2-morpholin-4-ylethyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16644692 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3,4-dimethyl-N-(2-morpholin-4-ylethyl)-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCN2CCOCC2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H21N3O5S/c1-11-9-13(10-14(12(11)2)17(18)19)23(20,21)15-3-4-16-5-7-22-8-6-16/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | LYSZJEJJDJPCAR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|