C14H22N2O6S2 — CID 110300194
2-methoxy-5-methylsulfonyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide (PubChem CID 110300194) has the molecular formula C14H22N2O6S2 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-methoxy-5-methylsulfonyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide.
| Compound Name | 2-methoxy-5-methylsulfonyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110300194 |
| Molecular Formula | C14H22N2O6S2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-methoxy-5-methylsulfonyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C14H22N2O6S2/c1-21-13-4-3-12(23(2,17)18)11-14(13)24(19,20)15-5-6-16-7-9-22-10-8-16/h3-4,11,15H,5-10H2,1-2H3 |
| InChIKey | FINMQCYBYYASBX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |