C14H21BrN2O4S — CID 2059491
5-bromo-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 2059491) has the molecular formula C14H21BrN2O4S and a molecular weight of 393.30 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2059491 |
| Molecular Formula | C14H21BrN2O4S |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 5-bromo-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C14H21BrN2O4S/c1-20-13-4-3-12(15)11-14(13)22(18,19)16-5-2-6-17-7-9-21-10-8-17/h3-4,11,16H,2,5-10H2,1H3 |
| InChIKey | JCJIUUMGVATHPI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|