C14H23Cl2N3O4S — CID 3047039
4-amino-5-chloro-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide;hydrochloride (PubChem CID 3047039) has the molecular formula C14H23Cl2N3O4S and a molecular weight of 400.33 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 3047039 |
| Molecular Formula | C14H23Cl2N3O4S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1S(=O)(=O)NCCCN1CCOCC1.Cl |
| InChI | InChI=1S/C14H22ClN3O4S.ClH/c1-21-13-10-12(16)11(15)9-14(13)23(19,20)17-3-2-4-18-5-7-22-8-6-18;/h9-10,17H,2-8,16H2,1H3;1H |
| InChIKey | GFPHUCRZGAWAPX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|