C12H21Cl2N3O3S — CID 3046709
4-amino-5-chloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide;hydrochloride (PubChem CID 3046709) has the molecular formula C12H21Cl2N3O3S and a molecular weight of 358.29 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 3046709 |
| Molecular Formula | C12H21Cl2N3O3S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-amino-5-chloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1S(=O)(=O)NCCCN(C)C.Cl |
| InChI | InChI=1S/C12H20ClN3O3S.ClH/c1-16(2)6-4-5-15-20(17,18)12-7-9(13)10(14)8-11(12)19-3;/h7-8,15H,4-6,14H2,1-3H3;1H |
| InChIKey | SUYZRORYGZZPQI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|