C12H18Cl2N2O3S — CID 110758544
3,5-dichloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide (PubChem CID 110758544) has the molecular formula C12H18Cl2N2O3S and a molecular weight of 341.26 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110758544 |
| Molecular Formula | C12H18Cl2N2O3S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3,5-dichloro-N-[3-(dimethylamino)propyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1c(Cl)cc(Cl)cc1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C12H18Cl2N2O3S/c1-16(2)6-4-5-15-20(17,18)11-8-9(13)7-10(14)12(11)19-3/h7-8,15H,4-6H2,1-3H3 |
| InChIKey | HHTIVWYSRAYGDD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|