C13H20ClN3O4S — CID 120894029
5-chloro-2-methoxy-N,N-dimethyl-3-[2-(methylamino)ethylsulfamoyl]benzamide (PubChem CID 120894029) has the molecular formula C13H20ClN3O4S and a molecular weight of 349.84 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N,N-dimethyl-3-[2-(methylamino)ethylsulfamoyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N,N-dimethyl-3-[2-(methylamino)ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 120894029 |
| Molecular Formula | C13H20ClN3O4S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 5-chloro-2-methoxy-N,N-dimethyl-3-[2-(methylamino)ethylsulfamoyl]benzamide |
| SMILES | CNCCNS(=O)(=O)c1cc(Cl)cc(C(=O)N(C)C)c1OC |
| InChI | InChI=1S/C13H20ClN3O4S/c1-15-5-6-16-22(19,20)11-8-9(14)7-10(12(11)21-4)13(18)17(2)3/h7-8,15-16H,5-6H2,1-4H3 |
| InChIKey | JSQCDJXVENFVDQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|