About 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride
3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride (PubChem CID 120894182) has the molecular formula C16H25Cl2N3O4S
and a molecular weight of 426.37 g/mol. Its IUPAC name is 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride |
| PubChem CID | 120894182 |
| Molecular Formula | C16H25Cl2N3O4S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride |
| SMILES | COc1c(C(=O)N(C)C)cc(Cl)cc1S(=O)(=O)NC1CCCC(N)C1.Cl |
| InChI | InChI=1S/C16H24ClN3O4S.ClH/c1-20(2)16(21)13-7-10(17)8-14(15(13)24-3)25(22,23)19-12-6-4-5-11(18)9-12;/h7-8,11-12,19H,4-6,9,18H2,1-3H3;1H |
| InChIKey | FUPBGMPJJCJDKG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride?
The IUPAC name of 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride (CID 120894182) is 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride.
What is the SMILES notation for 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride?
The canonical SMILES for 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride is COc1c(C(=O)N(C)C)cc(Cl)cc1S(=O)(=O)NC1CCCC(N)C1.Cl.
What is the InChIKey of 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride?
The InChIKey is FUPBGMPJJCJDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClN3O4S.ClH/c1-20(2)16(21)13-7-10(17)8-14(15(13)24-3)25(22,23)19-12-6-4-5-11(18)9-12;/h7-8,11-12,19H,4-6,9,18H2,1-3H3;1H.
What are the key properties of 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride?
3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride has a molecular weight of 426.37 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-aminocyclohexyl)sulfamoyl]-5-chloro-2-methoxy-N,N-dimethylbenzamide;hydrochloride is sourced from PubChem (CID 120894182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).