C10H9ClF3NO5S — CID 43510552
5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid (PubChem CID 43510552) has the molecular formula C10H9ClF3NO5S and a molecular weight of 347.70 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43510552 |
| Molecular Formula | C10H9ClF3NO5S |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid |
| SMILES | COc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NO5S/c1-20-8-6(9(16)17)2-5(11)3-7(8)21(18,19)15-4-10(12,13)14/h2-3,15H,4H2,1H3,(H,16,17) |
| InChIKey | UJCBQIKKUMJVRK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |