C12H14ClNO6S — CID 43510582
5-chloro-2-methoxy-3-[1-(methylamino)-1-oxopropan-2-yl]sulfonylbenzoic acid (PubChem CID 43510582) has the molecular formula C12H14ClNO6S and a molecular weight of 335.77 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-[1-(methylamino)-1-oxopropan-2-yl]sulfonylbenzoic acid.
| Compound Name | 5-chloro-2-methoxy-3-[1-(methylamino)-1-oxopropan-2-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43510582 |
| Molecular Formula | C12H14ClNO6S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5-chloro-2-methoxy-3-[1-(methylamino)-1-oxopropan-2-yl]sulfonylbenzoic acid |
| SMILES | CNC(=O)C(C)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1OC |
| InChI | InChI=1S/C12H14ClNO6S/c1-6(11(15)14-2)21(18,19)9-5-7(13)4-8(12(16)17)10(9)20-3/h4-6H,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | AFBDIMDYSCJFHG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |