C10H8ClF3O5S — CID 43510587
5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid (PubChem CID 43510587) has the molecular formula C10H8ClF3O5S and a molecular weight of 332.68 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43510587 |
| Molecular Formula | C10H8ClF3O5S |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 5-chloro-2-methoxy-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
| SMILES | COc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H8ClF3O5S/c1-19-8-6(9(15)16)2-5(11)3-7(8)20(17,18)4-10(12,13)14/h2-3H,4H2,1H3,(H,15,16) |
| InChIKey | BNLJBJPNZQPGBR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |