C13H11ClO5S2 — CID 43646414
5-chloro-2-methoxy-3-(thiophen-3-ylmethylsulfonyl)benzoic acid (PubChem CID 43646414) has the molecular formula C13H11ClO5S2 and a molecular weight of 346.81 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-(thiophen-3-ylmethylsulfonyl)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-3-(thiophen-3-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43646414 |
| Molecular Formula | C13H11ClO5S2 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 5-chloro-2-methoxy-3-(thiophen-3-ylmethylsulfonyl)benzoic acid |
| SMILES | COc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)Cc1ccsc1 |
| InChI | InChI=1S/C13H11ClO5S2/c1-19-12-10(13(15)16)4-9(14)5-11(12)21(17,18)7-8-2-3-20-6-8/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | CLQMOUBEBDNVOJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |