C12H16ClNO5S2 — CID 115985481
5-chloro-2-methoxy-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid (PubChem CID 115985481) has the molecular formula C12H16ClNO5S2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid.
| Compound Name | 5-chloro-2-methoxy-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 115985481 |
| Molecular Formula | C12H16ClNO5S2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 5-chloro-2-methoxy-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid |
| SMILES | COc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)N(C)CCSC |
| InChI | InChI=1S/C12H16ClNO5S2/c1-14(4-5-20-3)21(17,18)10-7-8(13)6-9(12(15)16)11(10)19-2/h6-7H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | QYEQMDSLXLYSEJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |