C11H14ClNO5S2 — CID 43525936
5-chloro-2-methoxy-3-(2-methylsulfanylethylsulfamoyl)benzoic acid (PubChem CID 43525936) has the molecular formula C11H14ClNO5S2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-(2-methylsulfanylethylsulfamoyl)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-3-(2-methylsulfanylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43525936 |
| Molecular Formula | C11H14ClNO5S2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 5-chloro-2-methoxy-3-(2-methylsulfanylethylsulfamoyl)benzoic acid |
| SMILES | COc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)NCCSC |
| InChI | InChI=1S/C11H14ClNO5S2/c1-18-10-8(11(14)15)5-7(12)6-9(10)20(16,17)13-3-4-19-2/h5-6,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | RCQVJEPZSKSGBW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|