C11H13Cl2NO4S2 — CID 115985502
2,5-dichloro-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid (PubChem CID 115985502) has the molecular formula C11H13Cl2NO4S2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2,5-dichloro-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid.
| Compound Name | 2,5-dichloro-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 115985502 |
| Molecular Formula | C11H13Cl2NO4S2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2,5-dichloro-3-[methyl(2-methylsulfanylethyl)sulfamoyl]benzoic acid |
| SMILES | CSCCN(C)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO4S2/c1-14(3-4-19-2)20(17,18)9-6-7(12)5-8(10(9)13)11(15)16/h5-6H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | DRSSKINDMDLCQB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |