2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid

C12H12Cl2N2O4S — CID 60950771

IUPAC2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid
SMILESCCN(CCC#N)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl
InChIInChI=1S/C12H12Cl2N2O4S/c1-2-16(5-3-4-15)21(19,20)10-7-8(13)6-9(11(10)14)12(17)18/h6-7H,2-3,5H2,1H3,(H,17,18)
InChIKeyUFLBXOXJJRSNKO-UHFFFAOYSA-N
MW351.21 g/mol
LogP2.62
Rot. Bonds6

About 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid

2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid (PubChem CID 60950771) has the molecular formula C12H12Cl2N2O4S and a molecular weight of 351.21 g/mol. Its IUPAC name is 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid.

Molecular Properties

Compound Name2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid
PubChem CID60950771
Molecular FormulaC12H12Cl2N2O4S
Molecular Weight351.21 g/mol
Exact Mass349.99
IUPAC Name2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid
SMILESCCN(CCC#N)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl
InChIInChI=1S/C12H12Cl2N2O4S/c1-2-16(5-3-4-15)21(19,20)10-7-8(13)6-9(11(10)14)12(17)18/h6-7H,2-3,5H2,1H3,(H,17,18)
InChIKeyUFLBXOXJJRSNKO-UHFFFAOYSA-N
XLogP2.62
TPSA98.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.21
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid?
The IUPAC name of 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid (CID 60950771) is 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid.
What is the SMILES notation for 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid?
The canonical SMILES for 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid is CCN(CCC#N)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl.
What is the InChIKey of 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid?
The InChIKey is UFLBXOXJJRSNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O4S/c1-2-16(5-3-4-15)21(19,20)10-7-8(13)6-9(11(10)14)12(17)18/h6-7H,2-3,5H2,1H3,(H,17,18).
What are the key properties of 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid?
2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid has a molecular weight of 351.21 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3-[2-cyanoethyl(ethyl)sulfamoyl]benzoic acid is sourced from PubChem (CID 60950771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).