C12H17N3O4S — CID 60951093
4-[2-cyanoethyl(ethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid (PubChem CID 60951093) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[2-cyanoethyl(ethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid.
| Compound Name | 4-[2-cyanoethyl(ethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 60951093 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-[2-cyanoethyl(ethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid |
| SMILES | CCN(CCC#N)S(=O)(=O)c1cc(C(=O)O)n(CC)c1 |
| InChI | InChI=1S/C12H17N3O4S/c1-3-14-9-10(8-11(14)12(16)17)20(18,19)15(4-2)7-5-6-13/h8-9H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | SBOSZHWTUDTPGU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |