C13H23N3O4S — CID 63694139
4-[3-(dimethylamino)propyl-methylsulfamoyl]-1-ethylpyrrole-2-carboxylic acid (PubChem CID 63694139) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl-methylsulfamoyl]-1-ethylpyrrole-2-carboxylic acid.
| Compound Name | 4-[3-(dimethylamino)propyl-methylsulfamoyl]-1-ethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 63694139 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[3-(dimethylamino)propyl-methylsulfamoyl]-1-ethylpyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)N(C)CCCN(C)C)cc1C(=O)O |
| InChI | InChI=1S/C13H23N3O4S/c1-5-16-10-11(9-12(16)13(17)18)21(19,20)15(4)8-6-7-14(2)3/h9-10H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | PLZRPQJAMLPQHQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |