C11H18N2O5S — CID 61041453
1-ethyl-4-[2-methoxyethyl(methyl)sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 61041453) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-ethyl-4-[2-methoxyethyl(methyl)sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-[2-methoxyethyl(methyl)sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 61041453 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-ethyl-4-[2-methoxyethyl(methyl)sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)N(C)CCOC)cc1C(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-4-13-8-9(7-10(13)11(14)15)19(16,17)12(2)5-6-18-3/h7-8H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | WMGWVGNAOGPBAV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |