C8H12N2O5S — CID 114612786
1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylic acid (PubChem CID 114612786) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114612786 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylic acid |
| SMILES | COCCn1cc(S(N)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C8H12N2O5S/c1-15-3-2-10-5-6(16(9,13)14)4-7(10)8(11)12/h4-5H,2-3H2,1H3,(H,11,12)(H2,9,13,14) |
| InChIKey | GEQCKCQFYSSHHQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |