C12H20N2O4S — CID 114612702
2-methylpropyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612702) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-methylpropyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | 2-methylpropyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612702 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-methylpropyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(S(N)(=O)=O)cc1C(=O)OCC(C)C |
| InChI | InChI=1S/C12H20N2O4S/c1-4-5-14-7-10(19(13,16)17)6-11(14)12(15)18-8-9(2)3/h6-7,9H,4-5,8H2,1-3H3,(H2,13,16,17) |
| InChIKey | NPHUOPATOUALDD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |