C10H16N2O4S — CID 114612614
ethyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612614) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is ethyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | ethyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612614 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | ethyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(S(N)(=O)=O)cn1C(C)C |
| InChI | InChI=1S/C10H16N2O4S/c1-4-16-10(13)9-5-8(17(11,14)15)6-12(9)7(2)3/h5-7H,4H2,1-3H3,(H2,11,14,15) |
| InChIKey | IOLSGOVJMWXNNI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |