C10H16N2O2 — CID 45089372
ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate (PubChem CID 45089372) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 45089372 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(N)cn1C(C)C |
| InChI | InChI=1S/C10H16N2O2/c1-4-14-10(13)9-5-8(11)6-12(9)7(2)3/h5-7H,4,11H2,1-3H3 |
| InChIKey | JUQSUPUCPSMFQK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |