C14H23N3O3 — CID 61485933
[2-(butylamino)-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate (PubChem CID 61485933) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61485933 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
| SMILES | CCCCNC(=O)COC(=O)c1cc(N)cn1C(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-4-5-6-16-13(18)9-20-14(19)12-7-11(15)8-17(12)10(2)3/h7-8,10H,4-6,9,15H2,1-3H3,(H,16,18) |
| InChIKey | OYUURYJFKNVFCE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|