C15H23N3O3 — CID 61488584
[2-[cyclopropyl(ethyl)amino]-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate (PubChem CID 61488584) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is [2-[cyclopropyl(ethyl)amino]-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate.
| Compound Name | [2-[cyclopropyl(ethyl)amino]-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61488584 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [2-[cyclopropyl(ethyl)amino]-2-oxoethyl] 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1cc(N)cn1C(C)C)C1CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-4-17(12-5-6-12)14(19)9-21-15(20)13-7-11(16)8-18(13)10(2)3/h7-8,10,12H,4-6,9,16H2,1-3H3 |
| InChIKey | UOXVBVLRAFFLCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |