C12H17F3N2O3 — CID 61490592
2-(2,2,2-trifluoroethoxy)ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate (PubChem CID 61490592) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate.
| Compound Name | 2-(2,2,2-trifluoroethoxy)ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61490592 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)ethyl 4-amino-1-propan-2-ylpyrrole-2-carboxylate |
| SMILES | CC(C)n1cc(N)cc1C(=O)OCCOCC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O3/c1-8(2)17-6-9(16)5-10(17)11(18)20-4-3-19-7-12(13,14)15/h5-6,8H,3-4,7,16H2,1-2H3 |
| InChIKey | NXLGPISQCRXARJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|