About 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate
3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612788) has the molecular formula C14H24N2O4S
and a molecular weight of 316.42 g/mol. Its IUPAC name is 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
| PubChem CID | 114612788 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | CC(C)n1cc(S(N)(=O)=O)cc1C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-10(2)16-9-11(21(15,18)19)8-12(16)13(17)20-7-6-14(3,4)5/h8-10H,6-7H2,1-5H3,(H2,15,18,19) |
| InChIKey | MUVFFUQFINIDCR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate?
The IUPAC name of 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate (CID 114612788) is 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate.
What is the SMILES notation for 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate?
The canonical SMILES for 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate is CC(C)n1cc(S(N)(=O)=O)cc1C(=O)OCCC(C)(C)C.
What is the InChIKey of 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate?
The InChIKey is MUVFFUQFINIDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O4S/c1-10(2)16-9-11(21(15,18)19)8-12(16)13(17)20-7-6-14(3,4)5/h8-10H,6-7H2,1-5H3,(H2,15,18,19).
What are the key properties of 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate?
3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate has a molecular weight of 316.42 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate is sourced from PubChem (CID 114612788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).