C14H24N2O4S — CID 114612788
3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612788) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612788 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3,3-dimethylbutyl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | CC(C)n1cc(S(N)(=O)=O)cc1C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-10(2)16-9-11(21(15,18)19)8-12(16)13(17)20-7-6-14(3,4)5/h8-10H,6-7H2,1-5H3,(H2,15,18,19) |
| InChIKey | MUVFFUQFINIDCR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |