C14H24N2O4S — CID 114612732
4-methylpentyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612732) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-methylpentyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | 4-methylpentyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612732 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-methylpentyl 1-propyl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(S(N)(=O)=O)cc1C(=O)OCCCC(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-4-7-16-10-12(21(15,18)19)9-13(16)14(17)20-8-5-6-11(2)3/h9-11H,4-8H2,1-3H3,(H2,15,18,19) |
| InChIKey | PWZWNJISHWUGLJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|