C13H22N2O5S — CID 114612712
3-methylbutyl 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612712) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 3-methylbutyl 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | 3-methylbutyl 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612712 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-methylbutyl 1-(2-methoxyethyl)-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | COCCn1cc(S(N)(=O)=O)cc1C(=O)OCCC(C)C |
| InChI | InChI=1S/C13H22N2O5S/c1-10(2)4-6-20-13(16)12-8-11(21(14,17)18)9-15(12)5-7-19-3/h8-10H,4-7H2,1-3H3,(H2,14,17,18) |
| InChIKey | LSLVOKLAWDYPJT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |