C13H23N3O4S — CID 114611929
1-(2-methoxyethyl)-N-pentyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114611929) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-pentyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-pentyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114611929 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(2-methoxyethyl)-N-pentyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(S(N)(=O)=O)cn1CCOC |
| InChI | InChI=1S/C13H23N3O4S/c1-3-4-5-6-15-13(17)12-9-11(21(14,18)19)10-16(12)7-8-20-2/h9-10H,3-8H2,1-2H3,(H,15,17)(H2,14,18,19) |
| InChIKey | KZDYPSMDYUYAFP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|