C13H23N3O4S — CID 114611880
1-(2-methoxyethyl)-N-(2-methylbutan-2-yl)-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114611880) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(2-methylbutan-2-yl)-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-(2-methylbutan-2-yl)-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114611880 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(2-methylbutan-2-yl)-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCC(C)(C)NC(=O)c1cc(S(N)(=O)=O)cn1CCOC |
| InChI | InChI=1S/C13H23N3O4S/c1-5-13(2,3)15-12(17)11-8-10(21(14,18)19)9-16(11)6-7-20-4/h8-9H,5-7H2,1-4H3,(H,15,17)(H2,14,18,19) |
| InChIKey | WPHLLLLJQSCKTG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |