C13H22N2O4S — CID 102988547
pentan-2-yl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 102988547) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is pentan-2-yl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | pentan-2-yl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 102988547 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | pentan-2-yl 1-propan-2-yl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | CCCC(C)OC(=O)c1cc(S(N)(=O)=O)cn1C(C)C |
| InChI | InChI=1S/C13H22N2O4S/c1-5-6-10(4)19-13(16)12-7-11(20(14,17)18)8-15(12)9(2)3/h7-10H,5-6H2,1-4H3,(H2,14,17,18) |
| InChIKey | IMLSEFOKUVGZJW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |