C14H25N3O3S — CID 114612172
N-(4-methylpentan-2-yl)-1-propan-2-yl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114612172) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(4-methylpentan-2-yl)-1-propan-2-yl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(4-methylpentan-2-yl)-1-propan-2-yl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114612172 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(4-methylpentan-2-yl)-1-propan-2-yl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CC(C)CC(C)NC(=O)c1cc(S(N)(=O)=O)cn1C(C)C |
| InChI | InChI=1S/C14H25N3O3S/c1-9(2)6-11(5)16-14(18)13-7-12(21(15,19)20)8-17(13)10(3)4/h7-11H,6H2,1-5H3,(H,16,18)(H2,15,19,20) |
| InChIKey | FAZRTBMLHHMVBF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |