C12H21N3O4S — CID 114612273
N-(1-ethoxypropan-2-yl)-1-ethyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114612273) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(1-ethoxypropan-2-yl)-1-ethyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(1-ethoxypropan-2-yl)-1-ethyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114612273 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(1-ethoxypropan-2-yl)-1-ethyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCOCC(C)NC(=O)c1cc(S(N)(=O)=O)cn1CC |
| InChI | InChI=1S/C12H21N3O4S/c1-4-15-7-10(20(13,17)18)6-11(15)12(16)14-9(3)8-19-5-2/h6-7,9H,4-5,8H2,1-3H3,(H,14,16)(H2,13,17,18) |
| InChIKey | ODWDSXCRFXCVAC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |