C11H19N3O3S — CID 65388360
N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide (PubChem CID 65388360) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65388360 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)CC(C)NC(=O)c1cc(S(N)(=O)=O)c[nH]1 |
| InChI | InChI=1S/C11H19N3O3S/c1-7(2)4-8(3)14-11(15)10-5-9(6-13-10)18(12,16)17/h5-8,13H,4H2,1-3H3,(H,14,15)(H2,12,16,17) |
| InChIKey | RRUSVSLEFGGZGG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |