C10H16N2O4S — CID 65380855
3-methylbutyl 4-sulfamoyl-1H-pyrrole-2-carboxylate (PubChem CID 65380855) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-methylbutyl 4-sulfamoyl-1H-pyrrole-2-carboxylate.
| Compound Name | 3-methylbutyl 4-sulfamoyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 65380855 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-methylbutyl 4-sulfamoyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(C)CCOC(=O)c1cc(S(N)(=O)=O)c[nH]1 |
| InChI | InChI=1S/C10H16N2O4S/c1-7(2)3-4-16-10(13)9-5-8(6-12-9)17(11,14)15/h5-7,12H,3-4H2,1-2H3,(H2,11,14,15) |
| InChIKey | VQHQHOCQWLNQQO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |