C9H15N3O5S2 — CID 65380794
N-(1-methylsulfonylpropan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide (PubChem CID 65380794) has the molecular formula C9H15N3O5S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(1-methylsulfonylpropan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-methylsulfonylpropan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65380794 |
| Molecular Formula | C9H15N3O5S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(1-methylsulfonylpropan-2-yl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(CS(C)(=O)=O)NC(=O)c1cc(S(N)(=O)=O)c[nH]1 |
| InChI | InChI=1S/C9H15N3O5S2/c1-6(5-18(2,14)15)12-9(13)8-3-7(4-11-8)19(10,16)17/h3-4,6,11H,5H2,1-2H3,(H,12,13)(H2,10,16,17) |
| InChIKey | LMGLBXCCNWWHNG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |