C7H9F2N3O3S — CID 115408908
N-(2,2-difluoroethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide (PubChem CID 115408908) has the molecular formula C7H9F2N3O3S and a molecular weight of 253.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115408908 |
| Molecular Formula | C7H9F2N3O3S |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)c1c[nH]c(C(=O)NCC(F)F)c1 |
| InChI | InChI=1S/C7H9F2N3O3S/c8-6(9)3-12-7(13)5-1-4(2-11-5)16(10,14)15/h1-2,6,11H,3H2,(H,12,13)(H2,10,14,15) |
| InChIKey | UFIWTBJYGBIDKZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |